C39H63N7O8 — CID 123762487
5-[[2-[[2-amino-4-[3-(decanoylamino)propylamino]butanoyl]amino]-3-(6-methyl-1H-indol-3-yl)propanoyl]amino]-2-(4-carboxybutanoylamino)pentanoic acid (PubChem CID 123762487) has the molecular formula C39H63N7O8 and a molecular weight of 757.97 g/mol. Its IUPAC name is 5-[[2-[[2-amino-4-[3-(decanoylamino)propylamino]butanoyl]amino]-3-(6-methyl-1H-indol-3-yl)propanoyl]amino]-2-(4-carboxybutanoylamino)pentanoic acid.
| Compound Name | 5-[[2-[[2-amino-4-[3-(decanoylamino)propylamino]butanoyl]amino]-3-(6-methyl-1H-indol-3-yl)propanoyl]amino]-2-(4-carboxybutanoylamino)pentanoic acid |
|---|---|
| PubChem CID | 123762487 |
| Molecular Formula | C39H63N7O8 |
| Molecular Weight | 757.97 g/mol |
| Exact Mass | 757.47 |
| IUPAC Name | 5-[[2-[[2-amino-4-[3-(decanoylamino)propylamino]butanoyl]amino]-3-(6-methyl-1H-indol-3-yl)propanoyl]amino]-2-(4-carboxybutanoylamino)pentanoic acid |
| SMILES | CCCCCCCCCC(=O)NCCCNCCC(N)C(=O)NC(Cc1c[nH]c2cc(C)ccc12)C(=O)NCCCC(NC(=O)CCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C39H63N7O8/c1-3-4-5-6-7-8-9-14-34(47)42-22-12-20-41-23-19-30(40)37(51)46-33(25-28-26-44-32-24-27(2)17-18-29(28)32)38(52)43-21-11-13-31(39(53)54)45-35(48)15-10-16-36(49)50/h17-18,24,26,30-31,33,41,44H,3-16,19-23,25,40H2,1-2H3,(H,42,47)(H,43,52)(H,45,48)(H,46,51)(H,49,50)(H,53,54) |
| InChIKey | RIFUWQCTGQBTOS-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 244.84 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.97 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|