About 2,3-di(ethylidene)-5,6-difluoro-1,4-dihydropyrazine
2,3-di(ethylidene)-5,6-difluoro-1,4-dihydropyrazine (PubChem CID 123762657) has the molecular formula C8H10F2N2
and a molecular weight of 172.18 g/mol. Its IUPAC name is 2,3-di(ethylidene)-5,6-difluoro-1,4-dihydropyrazine.
Molecular Properties
| Compound Name | 2,3-di(ethylidene)-5,6-difluoro-1,4-dihydropyrazine |
| PubChem CID | 123762657 |
| Molecular Formula | C8H10F2N2 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | 2,3-di(ethylidene)-5,6-difluoro-1,4-dihydropyrazine |
| SMILES | CC=C1NC(F)=C(F)NC1=CC |
| InChI | InChI=1S/C8H10F2N2/c1-3-5-6(4-2)12-8(10)7(9)11-5/h3-4,11-12H,1-2H3 |
| InChIKey | UNDJNWXIVQLVDT-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2,3-di(ethylidene)-5,6-difluoro-1,4-dihydropyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-di(ethylidene)-5,6-difluoro-1,4-dihydropyrazine?
The IUPAC name of 2,3-di(ethylidene)-5,6-difluoro-1,4-dihydropyrazine (CID 123762657) is 2,3-di(ethylidene)-5,6-difluoro-1,4-dihydropyrazine.
What is the SMILES notation for 2,3-di(ethylidene)-5,6-difluoro-1,4-dihydropyrazine?
The canonical SMILES for 2,3-di(ethylidene)-5,6-difluoro-1,4-dihydropyrazine is CC=C1NC(F)=C(F)NC1=CC.
What is the InChIKey of 2,3-di(ethylidene)-5,6-difluoro-1,4-dihydropyrazine?
The InChIKey is UNDJNWXIVQLVDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10F2N2/c1-3-5-6(4-2)12-8(10)7(9)11-5/h3-4,11-12H,1-2H3.
What are the key properties of 2,3-di(ethylidene)-5,6-difluoro-1,4-dihydropyrazine?
2,3-di(ethylidene)-5,6-difluoro-1,4-dihydropyrazine has a molecular weight of 172.18 g/mol, XLogP of 2.05, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-di(ethylidene)-5,6-difluoro-1,4-dihydropyrazine is sourced from PubChem (CID 123762657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).