C28H31F5N2O — CID 123762835
4-(3,3-difluorocyclobutyl)-3-ethyl-5,8,8-trimethyl-5-[3-(trifluoromethyl)phenyl]-3,7,9,10-tetrahydro-2H-benzo[b][1,8]naphthyridin-6-one (PubChem CID 123762835) has the molecular formula C28H31F5N2O and a molecular weight of 506.56 g/mol. Its IUPAC name is 4-(3,3-difluorocyclobutyl)-3-ethyl-5,8,8-trimethyl-5-[3-(trifluoromethyl)phenyl]-3,7,9,10-tetrahydro-2H-benzo[b][1,8]naphthyridin-6-one.
| Compound Name | 4-(3,3-difluorocyclobutyl)-3-ethyl-5,8,8-trimethyl-5-[3-(trifluoromethyl)phenyl]-3,7,9,10-tetrahydro-2H-benzo[b][1,8]naphthyridin-6-one |
|---|---|
| PubChem CID | 123762835 |
| Molecular Formula | C28H31F5N2O |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.24 |
| IUPAC Name | 4-(3,3-difluorocyclobutyl)-3-ethyl-5,8,8-trimethyl-5-[3-(trifluoromethyl)phenyl]-3,7,9,10-tetrahydro-2H-benzo[b][1,8]naphthyridin-6-one |
| SMILES | CCC1CN=C2NC3=C(C(=O)CC(C)(C)C3)C(C)(c3cccc(C(F)(F)F)c3)C2=C1C1CC(F)(F)C1 |
| InChI | InChI=1S/C28H31F5N2O/c1-5-15-14-34-24-23(21(15)16-10-27(29,30)11-16)26(4,17-7-6-8-18(9-17)28(31,32)33)22-19(35-24)12-25(2,3)13-20(22)36/h6-9,15-16H,5,10-14H2,1-4H3,(H,34,35) |
| InChIKey | MJIRCZBPUALDOE-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |