C16H25ClO3 — CID 123763070
4-(3-chloro-2-methylpenta-2,4-dienyl)-2,2-diethyl-5-(1-methoxyethenyl)-1,3-dioxolane (PubChem CID 123763070) has the molecular formula C16H25ClO3 and a molecular weight of 300.83 g/mol. Its IUPAC name is 4-(3-chloro-2-methylpenta-2,4-dienyl)-2,2-diethyl-5-(1-methoxyethenyl)-1,3-dioxolane.
| Compound Name | 4-(3-chloro-2-methylpenta-2,4-dienyl)-2,2-diethyl-5-(1-methoxyethenyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 123763070 |
| Molecular Formula | C16H25ClO3 |
| Molecular Weight | 300.83 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 4-(3-chloro-2-methylpenta-2,4-dienyl)-2,2-diethyl-5-(1-methoxyethenyl)-1,3-dioxolane |
| SMILES | C=CC(Cl)=C(C)CC1OC(CC)(CC)OC1C(=C)OC |
| InChI | InChI=1S/C16H25ClO3/c1-7-13(17)11(4)10-14-15(12(5)18-6)20-16(8-2,9-3)19-14/h7,14-15H,1,5,8-10H2,2-4,6H3 |
| InChIKey | NWHYJJBPRMXCIF-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.83 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|