C16H26O5Si — CID 123763285
(2R,6S)-1-[2-[tert-butyl(methyl)silyl]oxyethyl]-7-methyl-4,10-dioxatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 123763285) has the molecular formula C16H26O5Si and a molecular weight of 326.47 g/mol. Its IUPAC name is (2R,6S)-1-[2-[tert-butyl(methyl)silyl]oxyethyl]-7-methyl-4,10-dioxatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (2R,6S)-1-[2-[tert-butyl(methyl)silyl]oxyethyl]-7-methyl-4,10-dioxatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 123763285 |
| Molecular Formula | C16H26O5Si |
| Molecular Weight | 326.47 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | (2R,6S)-1-[2-[tert-butyl(methyl)silyl]oxyethyl]-7-methyl-4,10-dioxatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | C[SiH](OCCC12CCC(C)(O1)[C@H]1C(=O)OC(=O)[C@H]12)C(C)(C)C |
| InChI | InChI=1S/C16H26O5Si/c1-14(2,3)22(5)19-9-8-16-7-6-15(4,21-16)10-11(16)13(18)20-12(10)17/h10-11,22H,6-9H2,1-5H3/t10-,11+,15?,16?,22?/m1/s1 |
| InChIKey | NBWHKULIMHECFS-AGKIRLQGSA-N |
| XLogP | 2.18 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.47 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|