C22H25F2N5O2 — CID 123763858
13-[4-[[[1-(1,1-difluoroprop-2-enyl)cyclopropyl]amino]methyl]cyclohexyl]-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraene-10,12-dione (PubChem CID 123763858) has the molecular formula C22H25F2N5O2 and a molecular weight of 429.47 g/mol. Its IUPAC name is 13-[4-[[[1-(1,1-difluoroprop-2-enyl)cyclopropyl]amino]methyl]cyclohexyl]-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraene-10,12-dione.
| Compound Name | 13-[4-[[[1-(1,1-difluoroprop-2-enyl)cyclopropyl]amino]methyl]cyclohexyl]-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraene-10,12-dione |
|---|---|
| PubChem CID | 123763858 |
| Molecular Formula | C22H25F2N5O2 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | 13-[4-[[[1-(1,1-difluoroprop-2-enyl)cyclopropyl]amino]methyl]cyclohexyl]-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraene-10,12-dione |
| SMILES | C=CC(F)(F)C1(NCC2CCC(n3c(=O)[nH]c(=O)c4cnc5[nH]ccc5c43)CC2)CC1 |
| InChI | InChI=1S/C22H25F2N5O2/c1-2-22(23,24)21(8-9-21)27-11-13-3-5-14(6-4-13)29-17-15-7-10-25-18(15)26-12-16(17)19(30)28-20(29)31/h2,7,10,12-14,27H,1,3-6,8-9,11H2,(H,25,26)(H,28,30,31) |
| InChIKey | UMSGAOSVXYBATI-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 95.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|