About CID 123763936
CID 123763936 (PubChem CID 123763936) has the molecular formula C34H38Cl2FN3O4
and a molecular weight of 642.60 g/mol.
Molecular Properties
| Compound Name | CID 123763936 |
| PubChem CID | 123763936 |
| Molecular Formula | C34H38Cl2FN3O4 |
| Molecular Weight | 642.60 g/mol |
| Exact Mass | 641.22 |
| IUPAC Name | — |
| SMILES | CCN1C(C(=O)NC23CCC(C(=O)O)(CC2)CC3)C(c2cccc(Cl)c2F)C2(C(=O)Nc3cc(Cl)ccc32)C12CCCCC2 |
| InChI | InChI=1S/C34H38Cl2FN3O4/c1-2-40-27(28(41)39-32-16-13-31(14-17-32,15-18-32)30(43)44)25(21-7-6-8-23(36)26(21)37)34(33(40)11-4-3-5-12-33)22-10-9-20(35)19-24(22)38-29(34)42/h6-10,19,25,27H,2-5,11-18H2,1H3,(H,38,42)(H,39,41)(H,43,44) |
| InChIKey | YJCZPJQGFSSFOL-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 642.60 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 123763936 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 123763936?
The IUPAC name of CID 123763936 (CID 123763936) is not available.
What is the SMILES notation for CID 123763936?
The canonical SMILES for CID 123763936 is CCN1C(C(=O)NC23CCC(C(=O)O)(CC2)CC3)C(c2cccc(Cl)c2F)C2(C(=O)Nc3cc(Cl)ccc32)C12CCCCC2.
What is the InChIKey of CID 123763936?
The InChIKey is YJCZPJQGFSSFOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H38Cl2FN3O4/c1-2-40-27(28(41)39-32-16-13-31(14-17-32,15-18-32)30(43)44)25(21-7-6-8-23(36)26(21)37)34(33(40)11-4-3-5-12-33)22-10-9-20(35)19-24(22)38-29(34)42/h6-10,19,25,27H,2-5,11-18H2,1H3,(H,38,42)(H,39,41)(H,43,44).
What are the key properties of CID 123763936?
CID 123763936 has a molecular weight of 642.60 g/mol, XLogP of 6.81, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 123763936 is sourced from PubChem (CID 123763936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).