C32H37FN5O5S+ — CID 123764024
2-fluoro-4-[(5-hydroxy-2-oxo-1H-imidazol-3-yl)methyl]-N-[1-(oxan-4-yl)piperidin-4-yl]-5-[4-(4-propan-2-yl-1,3-thiazet-1-ium-2-yl)phenoxy]benzamide (PubChem CID 123764024) has the molecular formula C32H37FN5O5S+ and a molecular weight of 622.74 g/mol. Its IUPAC name is 2-fluoro-4-[(5-hydroxy-2-oxo-1H-imidazol-3-yl)methyl]-N-[1-(oxan-4-yl)piperidin-4-yl]-5-[4-(4-propan-2-yl-1,3-thiazet-1-ium-2-yl)phenoxy]benzamide.
| Compound Name | 2-fluoro-4-[(5-hydroxy-2-oxo-1H-imidazol-3-yl)methyl]-N-[1-(oxan-4-yl)piperidin-4-yl]-5-[4-(4-propan-2-yl-1,3-thiazet-1-ium-2-yl)phenoxy]benzamide |
|---|---|
| PubChem CID | 123764024 |
| Molecular Formula | C32H37FN5O5S+ |
| Molecular Weight | 622.74 g/mol |
| Exact Mass | 622.25 |
| IUPAC Name | 2-fluoro-4-[(5-hydroxy-2-oxo-1H-imidazol-3-yl)methyl]-N-[1-(oxan-4-yl)piperidin-4-yl]-5-[4-(4-propan-2-yl-1,3-thiazet-1-ium-2-yl)phenoxy]benzamide |
| SMILES | CC(C)C1=NC(c2ccc(Oc3cc(C(=O)NC4CCN(C5CCOCC5)CC4)c(F)cc3Cn3cc(O)[nH]c3=O)cc2)=[S+]1 |
| InChI | InChI=1S/C32H36FN5O5S/c1-19(2)30-36-31(44-30)20-3-5-24(6-4-20)43-27-16-25(26(33)15-21(27)17-38-18-28(39)35-32(38)41)29(40)34-22-7-11-37(12-8-22)23-9-13-42-14-10-23/h3-6,15-16,18-19,22-23H,7-14,17H2,1-2H3,(H2-,34,35,39,40,41)/p+1 |
| InChIKey | AMZKPHKKPUQDTG-UHFFFAOYSA-O |
| XLogP | 3.86 |
| TPSA | 121.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.74 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|