C17H14BrN3O3 — CID 123764142
1-N-[(2-bromo-3-phenylprop-2-enylidene)amino]-4-N-hydroxybenzene-1,4-dicarboxamide (PubChem CID 123764142) has the molecular formula C17H14BrN3O3 and a molecular weight of 388.22 g/mol. Its IUPAC name is 1-N-[(2-bromo-3-phenylprop-2-enylidene)amino]-4-N-hydroxybenzene-1,4-dicarboxamide.
| Compound Name | 1-N-[(2-bromo-3-phenylprop-2-enylidene)amino]-4-N-hydroxybenzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 123764142 |
| Molecular Formula | C17H14BrN3O3 |
| Molecular Weight | 388.22 g/mol |
| Exact Mass | 387.02 |
| IUPAC Name | 1-N-[(2-bromo-3-phenylprop-2-enylidene)amino]-4-N-hydroxybenzene-1,4-dicarboxamide |
| SMILES | O=C(NO)c1ccc(C(=O)NN=CC(Br)=Cc2ccccc2)cc1 |
| InChI | InChI=1S/C17H14BrN3O3/c18-15(10-12-4-2-1-3-5-12)11-19-20-16(22)13-6-8-14(9-7-13)17(23)21-24/h1-11,24H,(H,20,22)(H,21,23) |
| InChIKey | FVRZAXUITHVNCX-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.22 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|