About (3Z)-5-fluorohexa-3,5-diene-2-thione
(3Z)-5-fluorohexa-3,5-diene-2-thione (PubChem CID 123764414) has the molecular formula C6H7FS
and a molecular weight of 130.19 g/mol. Its IUPAC name is (3Z)-5-fluorohexa-3,5-diene-2-thione.
Molecular Properties
| Compound Name | (3Z)-5-fluorohexa-3,5-diene-2-thione |
| PubChem CID | 123764414 |
| Molecular Formula | C6H7FS |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.03 |
| IUPAC Name | (3Z)-5-fluorohexa-3,5-diene-2-thione |
| SMILES | C=C(F)/C=C\C(C)=S |
| InChI | InChI=1S/C6H7FS/c1-5(7)3-4-6(2)8/h3-4H,1H2,2H3/b4-3- |
| InChIKey | JLBNTOJNRYUKAQ-ARJAWSKDSA-N |
| XLogP | 2.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-5-fluorohexa-3,5-diene-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-5-fluorohexa-3,5-diene-2-thione?
The IUPAC name of (3Z)-5-fluorohexa-3,5-diene-2-thione (CID 123764414) is (3Z)-5-fluorohexa-3,5-diene-2-thione.
What is the SMILES notation for (3Z)-5-fluorohexa-3,5-diene-2-thione?
The canonical SMILES for (3Z)-5-fluorohexa-3,5-diene-2-thione is C=C(F)/C=C\C(C)=S.
What is the InChIKey of (3Z)-5-fluorohexa-3,5-diene-2-thione?
The InChIKey is JLBNTOJNRYUKAQ-ARJAWSKDSA-N. The full InChI is InChI=1S/C6H7FS/c1-5(7)3-4-6(2)8/h3-4H,1H2,2H3/b4-3-.
What are the key properties of (3Z)-5-fluorohexa-3,5-diene-2-thione?
(3Z)-5-fluorohexa-3,5-diene-2-thione has a molecular weight of 130.19 g/mol, XLogP of 2.42, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-5-fluorohexa-3,5-diene-2-thione is sourced from PubChem (CID 123764414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).