C25H25NO3S — CID 123764464
methyl 3-[4-(6-methoxy-1-methyl-2-thiophen-3-yl-3,4-dihydroisoquinolin-1-yl)phenyl]prop-2-enoate (PubChem CID 123764464) has the molecular formula C25H25NO3S and a molecular weight of 419.55 g/mol. Its IUPAC name is methyl 3-[4-(6-methoxy-1-methyl-2-thiophen-3-yl-3,4-dihydroisoquinolin-1-yl)phenyl]prop-2-enoate.
| Compound Name | methyl 3-[4-(6-methoxy-1-methyl-2-thiophen-3-yl-3,4-dihydroisoquinolin-1-yl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 123764464 |
| Molecular Formula | C25H25NO3S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | methyl 3-[4-(6-methoxy-1-methyl-2-thiophen-3-yl-3,4-dihydroisoquinolin-1-yl)phenyl]prop-2-enoate |
| SMILES | COC(=O)C=Cc1ccc(C2(C)c3ccc(OC)cc3CCN2c2ccsc2)cc1 |
| InChI | InChI=1S/C25H25NO3S/c1-25(20-7-4-18(5-8-20)6-11-24(27)29-3)23-10-9-22(28-2)16-19(23)12-14-26(25)21-13-15-30-17-21/h4-11,13,15-17H,12,14H2,1-3H3 |
| InChIKey | XYXLQMJKSYNFQB-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|