C11H11N — CID 123764551
3,9a-dihydrobenzo[7]annulen-5-imine (PubChem CID 123764551) has the molecular formula C11H11N and a molecular weight of 157.22 g/mol. Its IUPAC name is 3,9a-dihydrobenzo[7]annulen-5-imine.
| Compound Name | 3,9a-dihydrobenzo[7]annulen-5-imine |
|---|---|
| PubChem CID | 123764551 |
| Molecular Formula | C11H11N |
| Molecular Weight | 157.22 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | 3,9a-dihydrobenzo[7]annulen-5-imine |
| SMILES | [H]/N=C1\C=CC=CC2C=CCC=C12 |
| InChI | InChI=1S/C11H11N/c12-11-8-4-2-6-9-5-1-3-7-10(9)11/h1-2,4-9,12H,3H2/b12-11+ |
| InChIKey | SZFLTBRMSTWKGT-VAWYXSNFSA-N |
| XLogP | 2.63 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.22 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|