C23H14F5N3O2S — CID 123765022
N-[5-[4-(hydroxymethyl)phenyl]-3-thiophen-2-ylpyrazin-2-yl]-2-(2,3,4,5,6-pentafluorophenyl)acetamide (PubChem CID 123765022) has the molecular formula C23H14F5N3O2S and a molecular weight of 491.44 g/mol. Its IUPAC name is N-[5-[4-(hydroxymethyl)phenyl]-3-thiophen-2-ylpyrazin-2-yl]-2-(2,3,4,5,6-pentafluorophenyl)acetamide.
| Compound Name | N-[5-[4-(hydroxymethyl)phenyl]-3-thiophen-2-ylpyrazin-2-yl]-2-(2,3,4,5,6-pentafluorophenyl)acetamide |
|---|---|
| PubChem CID | 123765022 |
| Molecular Formula | C23H14F5N3O2S |
| Molecular Weight | 491.44 g/mol |
| Exact Mass | 491.07 |
| IUPAC Name | N-[5-[4-(hydroxymethyl)phenyl]-3-thiophen-2-ylpyrazin-2-yl]-2-(2,3,4,5,6-pentafluorophenyl)acetamide |
| SMILES | O=C(Cc1c(F)c(F)c(F)c(F)c1F)Nc1ncc(-c2ccc(CO)cc2)nc1-c1cccs1 |
| InChI | InChI=1S/C23H14F5N3O2S/c24-17-13(18(25)20(27)21(28)19(17)26)8-16(33)31-23-22(15-2-1-7-34-15)30-14(9-29-23)12-5-3-11(10-32)4-6-12/h1-7,9,32H,8,10H2,(H,29,31,33) |
| InChIKey | NDMRXWMGTSGSCL-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.44 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|