About hexa-3,4-dien-3-yl-dimethyl-propan-2-ylsilane
hexa-3,4-dien-3-yl-dimethyl-propan-2-ylsilane (PubChem CID 123765176) has the molecular formula C11H22Si
and a molecular weight of 182.38 g/mol. Its IUPAC name is hexa-3,4-dien-3-yl-dimethyl-propan-2-ylsilane.
Molecular Properties
| Compound Name | hexa-3,4-dien-3-yl-dimethyl-propan-2-ylsilane |
| PubChem CID | 123765176 |
| Molecular Formula | C11H22Si |
| Molecular Weight | 182.38 g/mol |
| Exact Mass | 182.15 |
| IUPAC Name | hexa-3,4-dien-3-yl-dimethyl-propan-2-ylsilane |
| SMILES | CC=C=C(CC)[Si](C)(C)C(C)C |
| InChI | InChI=1S/C11H22Si/c1-7-9-11(8-2)12(5,6)10(3)4/h7,10H,8H2,1-6H3 |
| InChIKey | IXFARXGAXLWRPQ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.38 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze hexa-3,4-dien-3-yl-dimethyl-propan-2-ylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexa-3,4-dien-3-yl-dimethyl-propan-2-ylsilane?
The IUPAC name of hexa-3,4-dien-3-yl-dimethyl-propan-2-ylsilane (CID 123765176) is hexa-3,4-dien-3-yl-dimethyl-propan-2-ylsilane.
What is the SMILES notation for hexa-3,4-dien-3-yl-dimethyl-propan-2-ylsilane?
The canonical SMILES for hexa-3,4-dien-3-yl-dimethyl-propan-2-ylsilane is CC=C=C(CC)[Si](C)(C)C(C)C.
What is the InChIKey of hexa-3,4-dien-3-yl-dimethyl-propan-2-ylsilane?
The InChIKey is IXFARXGAXLWRPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22Si/c1-7-9-11(8-2)12(5,6)10(3)4/h7,10H,8H2,1-6H3.
What are the key properties of hexa-3,4-dien-3-yl-dimethyl-propan-2-ylsilane?
hexa-3,4-dien-3-yl-dimethyl-propan-2-ylsilane has a molecular weight of 182.38 g/mol, XLogP of 4.16, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for hexa-3,4-dien-3-yl-dimethyl-propan-2-ylsilane is sourced from PubChem (CID 123765176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).