C25H40N2O6 — CID 123765487
17-[N-(2-methoxyethoxy)-C-methylcarbonimidoyl]-6-methoxyimino-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2,3,14-triol (PubChem CID 123765487) has the molecular formula C25H40N2O6 and a molecular weight of 464.60 g/mol. Its IUPAC name is 17-[N-(2-methoxyethoxy)-C-methylcarbonimidoyl]-6-methoxyimino-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2,3,14-triol.
| Compound Name | 17-[N-(2-methoxyethoxy)-C-methylcarbonimidoyl]-6-methoxyimino-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2,3,14-triol |
|---|---|
| PubChem CID | 123765487 |
| Molecular Formula | C25H40N2O6 |
| Molecular Weight | 464.60 g/mol |
| Exact Mass | 464.29 |
| IUPAC Name | 17-[N-(2-methoxyethoxy)-C-methylcarbonimidoyl]-6-methoxyimino-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2,3,14-triol |
| SMILES | COCCON=C(C)C1CCC2(O)C3=CC(=NOC)C4CC(O)C(O)CC4(C)C3CCC12C |
| InChI | InChI=1S/C25H40N2O6/c1-15(26-33-11-10-31-4)16-7-9-25(30)18-12-20(27-32-5)19-13-21(28)22(29)14-23(19,2)17(18)6-8-24(16,25)3/h12,16-17,19,21-22,28-30H,6-11,13-14H2,1-5H3 |
| InChIKey | USTSJNXOHGGACZ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 113.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.60 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|