About 1-(3-ethylsulfonylprop-2-enyl)-3,5-dimethylpiperazine
1-(3-ethylsulfonylprop-2-enyl)-3,5-dimethylpiperazine (PubChem CID 123765812) has the molecular formula C11H22N2O2S
and a molecular weight of 246.38 g/mol. Its IUPAC name is 1-(3-ethylsulfonylprop-2-enyl)-3,5-dimethylpiperazine.
Molecular Properties
| Compound Name | 1-(3-ethylsulfonylprop-2-enyl)-3,5-dimethylpiperazine |
| PubChem CID | 123765812 |
| Molecular Formula | C11H22N2O2S |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 1-(3-ethylsulfonylprop-2-enyl)-3,5-dimethylpiperazine |
| SMILES | CCS(=O)(=O)C=CCN1CC(C)NC(C)C1 |
| InChI | InChI=1S/C11H22N2O2S/c1-4-16(14,15)7-5-6-13-8-10(2)12-11(3)9-13/h5,7,10-12H,4,6,8-9H2,1-3H3 |
| InChIKey | HGHFDDGJLQLDMH-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(3-ethylsulfonylprop-2-enyl)-3,5-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-ethylsulfonylprop-2-enyl)-3,5-dimethylpiperazine?
The IUPAC name of 1-(3-ethylsulfonylprop-2-enyl)-3,5-dimethylpiperazine (CID 123765812) is 1-(3-ethylsulfonylprop-2-enyl)-3,5-dimethylpiperazine.
What is the SMILES notation for 1-(3-ethylsulfonylprop-2-enyl)-3,5-dimethylpiperazine?
The canonical SMILES for 1-(3-ethylsulfonylprop-2-enyl)-3,5-dimethylpiperazine is CCS(=O)(=O)C=CCN1CC(C)NC(C)C1.
What is the InChIKey of 1-(3-ethylsulfonylprop-2-enyl)-3,5-dimethylpiperazine?
The InChIKey is HGHFDDGJLQLDMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O2S/c1-4-16(14,15)7-5-6-13-8-10(2)12-11(3)9-13/h5,7,10-12H,4,6,8-9H2,1-3H3.
What are the key properties of 1-(3-ethylsulfonylprop-2-enyl)-3,5-dimethylpiperazine?
1-(3-ethylsulfonylprop-2-enyl)-3,5-dimethylpiperazine has a molecular weight of 246.38 g/mol, XLogP of 0.62, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-ethylsulfonylprop-2-enyl)-3,5-dimethylpiperazine is sourced from PubChem (CID 123765812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).