C27H54O6 — CID 123766006
(3,4-dihydroxy-2-methylpentyl) 7,8-dihydroxy-3,3,5,5,10,10,12,12-octamethyltridecanoate (PubChem CID 123766006) has the molecular formula C27H54O6 and a molecular weight of 474.72 g/mol. Its IUPAC name is (3,4-dihydroxy-2-methylpentyl) 7,8-dihydroxy-3,3,5,5,10,10,12,12-octamethyltridecanoate.
| Compound Name | (3,4-dihydroxy-2-methylpentyl) 7,8-dihydroxy-3,3,5,5,10,10,12,12-octamethyltridecanoate |
|---|---|
| PubChem CID | 123766006 |
| Molecular Formula | C27H54O6 |
| Molecular Weight | 474.72 g/mol |
| Exact Mass | 474.39 |
| IUPAC Name | (3,4-dihydroxy-2-methylpentyl) 7,8-dihydroxy-3,3,5,5,10,10,12,12-octamethyltridecanoate |
| SMILES | CC(O)C(O)C(C)COC(=O)CC(C)(C)CC(C)(C)CC(O)C(O)CC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C27H54O6/c1-18(23(32)19(2)28)15-33-22(31)14-27(10,11)17-26(8,9)13-21(30)20(29)12-25(6,7)16-24(3,4)5/h18-21,23,28-30,32H,12-17H2,1-11H3 |
| InChIKey | UBNWBJCTIUFTAT-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.72 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |