C10H12O2 — CID 123766274
4-hydroxy-3,4,4a,7-tetrahydro-2H-naphthalen-1-one (PubChem CID 123766274) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is 4-hydroxy-3,4,4a,7-tetrahydro-2H-naphthalen-1-one.
| Compound Name | 4-hydroxy-3,4,4a,7-tetrahydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 123766274 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 4-hydroxy-3,4,4a,7-tetrahydro-2H-naphthalen-1-one |
| SMILES | O=C1CCC(O)C2C=CCC=C12 |
| InChI | InChI=1S/C10H12O2/c11-9-5-6-10(12)8-4-2-1-3-7(8)9/h1,3-4,7,9,11H,2,5-6H2 |
| InChIKey | OLQZNPBELVFFDA-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|