C11H22O7 — CID 123766298
[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxy-2,4-dimethylheptyl] acetate (PubChem CID 123766298) has the molecular formula C11H22O7 and a molecular weight of 266.29 g/mol. Its IUPAC name is [(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxy-2,4-dimethylheptyl] acetate.
| Compound Name | [(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxy-2,4-dimethylheptyl] acetate |
|---|---|
| PubChem CID | 123766298 |
| Molecular Formula | C11H22O7 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | [(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxy-2,4-dimethylheptyl] acetate |
| SMILES | CC(=O)OC[C@](C)(O)[C@@H](O)[C@](C)(O)[C@H](O)C(C)O |
| InChI | InChI=1S/C11H22O7/c1-6(12)8(14)11(4,17)9(15)10(3,16)5-18-7(2)13/h6,8-9,12,14-17H,5H2,1-4H3/t6?,8-,9-,10+,11-/m1/s1 |
| InChIKey | WESBIRKOJULFHE-XVVDWHTOSA-N |
| XLogP | -1.85 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |