C28H48O2 — CID 123766383
1-[1-(2-cyclohexylethoxy)-2,2-dimethylpropoxy]-4-(2,2,5-trimethylhexan-3-yl)benzene (PubChem CID 123766383) has the molecular formula C28H48O2 and a molecular weight of 416.69 g/mol. Its IUPAC name is 1-[1-(2-cyclohexylethoxy)-2,2-dimethylpropoxy]-4-(2,2,5-trimethylhexan-3-yl)benzene.
| Compound Name | 1-[1-(2-cyclohexylethoxy)-2,2-dimethylpropoxy]-4-(2,2,5-trimethylhexan-3-yl)benzene |
|---|---|
| PubChem CID | 123766383 |
| Molecular Formula | C28H48O2 |
| Molecular Weight | 416.69 g/mol |
| Exact Mass | 416.37 |
| IUPAC Name | 1-[1-(2-cyclohexylethoxy)-2,2-dimethylpropoxy]-4-(2,2,5-trimethylhexan-3-yl)benzene |
| SMILES | CC(C)CC(c1ccc(OC(OCCC2CCCCC2)C(C)(C)C)cc1)C(C)(C)C |
| InChI | InChI=1S/C28H48O2/c1-21(2)20-25(27(3,4)5)23-14-16-24(17-15-23)30-26(28(6,7)8)29-19-18-22-12-10-9-11-13-22/h14-17,21-22,25-26H,9-13,18-20H2,1-8H3 |
| InChIKey | CTJWZLKFATWJKT-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.69 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|