About (4R)-4-(cyclopropylmethyl)-2,2-dimethyl-1,3-dioxolane
(4R)-4-(cyclopropylmethyl)-2,2-dimethyl-1,3-dioxolane (PubChem CID 123766397) has the molecular formula C9H16O2
and a molecular weight of 156.22 g/mol. Its IUPAC name is (4R)-4-(cyclopropylmethyl)-2,2-dimethyl-1,3-dioxolane.
Molecular Properties
| Compound Name | (4R)-4-(cyclopropylmethyl)-2,2-dimethyl-1,3-dioxolane |
| PubChem CID | 123766397 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | (4R)-4-(cyclopropylmethyl)-2,2-dimethyl-1,3-dioxolane |
| SMILES | CC1(C)OC[C@@H](CC2CC2)O1 |
| InChI | InChI=1S/C9H16O2/c1-9(2)10-6-8(11-9)5-7-3-4-7/h7-8H,3-6H2,1-2H3/t8-/m1/s1 |
| InChIKey | SFECNALUYLXAHM-MRVPVSSYSA-N |
| XLogP | 1.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4R)-4-(cyclopropylmethyl)-2,2-dimethyl-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-(cyclopropylmethyl)-2,2-dimethyl-1,3-dioxolane?
The IUPAC name of (4R)-4-(cyclopropylmethyl)-2,2-dimethyl-1,3-dioxolane (CID 123766397) is (4R)-4-(cyclopropylmethyl)-2,2-dimethyl-1,3-dioxolane.
What is the SMILES notation for (4R)-4-(cyclopropylmethyl)-2,2-dimethyl-1,3-dioxolane?
The canonical SMILES for (4R)-4-(cyclopropylmethyl)-2,2-dimethyl-1,3-dioxolane is CC1(C)OC[C@@H](CC2CC2)O1.
What is the InChIKey of (4R)-4-(cyclopropylmethyl)-2,2-dimethyl-1,3-dioxolane?
The InChIKey is SFECNALUYLXAHM-MRVPVSSYSA-N. The full InChI is InChI=1S/C9H16O2/c1-9(2)10-6-8(11-9)5-7-3-4-7/h7-8H,3-6H2,1-2H3/t8-/m1/s1.
What are the key properties of (4R)-4-(cyclopropylmethyl)-2,2-dimethyl-1,3-dioxolane?
(4R)-4-(cyclopropylmethyl)-2,2-dimethyl-1,3-dioxolane has a molecular weight of 156.22 g/mol, XLogP of 1.94, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-(cyclopropylmethyl)-2,2-dimethyl-1,3-dioxolane is sourced from PubChem (CID 123766397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).