C26H47NO4 — CID 123766881
N-[(Z)-6-hydroxy-5,7,10-trimethyl-8,12-dioxotridec-9-enyl]-3,4,5-trimethylheptanamide (PubChem CID 123766881) has the molecular formula C26H47NO4 and a molecular weight of 437.67 g/mol. Its IUPAC name is N-[(Z)-6-hydroxy-5,7,10-trimethyl-8,12-dioxotridec-9-enyl]-3,4,5-trimethylheptanamide.
| Compound Name | N-[(Z)-6-hydroxy-5,7,10-trimethyl-8,12-dioxotridec-9-enyl]-3,4,5-trimethylheptanamide |
|---|---|
| PubChem CID | 123766881 |
| Molecular Formula | C26H47NO4 |
| Molecular Weight | 437.67 g/mol |
| Exact Mass | 437.35 |
| IUPAC Name | N-[(Z)-6-hydroxy-5,7,10-trimethyl-8,12-dioxotridec-9-enyl]-3,4,5-trimethylheptanamide |
| SMILES | CCC(C)C(C)C(C)CC(=O)NCCCCC(C)C(O)C(C)C(=O)/C=C(/C)CC(C)=O |
| InChI | InChI=1S/C26H47NO4/c1-9-18(3)22(7)20(5)16-25(30)27-13-11-10-12-19(4)26(31)23(8)24(29)15-17(2)14-21(6)28/h15,18-20,22-23,26,31H,9-14,16H2,1-8H3,(H,27,30)/b17-15- |
| InChIKey | VXZVISTXXWTALH-ICFOKQHNSA-N |
| XLogP | 5.11 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.67 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|