About 1-(5-ethyl-3,5-dimethylheptan-3-yl)-3-(4-ethylphenyl)imidazol-1-ium
1-(5-ethyl-3,5-dimethylheptan-3-yl)-3-(4-ethylphenyl)imidazol-1-ium (PubChem CID 123767429) has the molecular formula C22H35N2+
and a molecular weight of 327.54 g/mol. Its IUPAC name is 1-(5-ethyl-3,5-dimethylheptan-3-yl)-3-(4-ethylphenyl)imidazol-1-ium.
Molecular Properties
| Compound Name | 1-(5-ethyl-3,5-dimethylheptan-3-yl)-3-(4-ethylphenyl)imidazol-1-ium |
| PubChem CID | 123767429 |
| Molecular Formula | C22H35N2+ |
| Molecular Weight | 327.54 g/mol |
| Exact Mass | 327.28 |
| IUPAC Name | 1-(5-ethyl-3,5-dimethylheptan-3-yl)-3-(4-ethylphenyl)imidazol-1-ium |
| SMILES | CCc1ccc(-n2cc[n+](C(C)(CC)CC(C)(CC)CC)c2)cc1 |
| InChI | InChI=1S/C22H35N2/c1-7-19-11-13-20(14-12-19)23-15-16-24(18-23)22(6,10-4)17-21(5,8-2)9-3/h11-16,18H,7-10,17H2,1-6H3/q+1 |
| InChIKey | NOMGFLNCFLYMGS-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 327.54 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-ethyl-3,5-dimethylheptan-3-yl)-3-(4-ethylphenyl)imidazol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-ethyl-3,5-dimethylheptan-3-yl)-3-(4-ethylphenyl)imidazol-1-ium?
The IUPAC name of 1-(5-ethyl-3,5-dimethylheptan-3-yl)-3-(4-ethylphenyl)imidazol-1-ium (CID 123767429) is 1-(5-ethyl-3,5-dimethylheptan-3-yl)-3-(4-ethylphenyl)imidazol-1-ium.
What is the SMILES notation for 1-(5-ethyl-3,5-dimethylheptan-3-yl)-3-(4-ethylphenyl)imidazol-1-ium?
The canonical SMILES for 1-(5-ethyl-3,5-dimethylheptan-3-yl)-3-(4-ethylphenyl)imidazol-1-ium is CCc1ccc(-n2cc[n+](C(C)(CC)CC(C)(CC)CC)c2)cc1.
What is the InChIKey of 1-(5-ethyl-3,5-dimethylheptan-3-yl)-3-(4-ethylphenyl)imidazol-1-ium?
The InChIKey is NOMGFLNCFLYMGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H35N2/c1-7-19-11-13-20(14-12-19)23-15-16-24(18-23)22(6,10-4)17-21(5,8-2)9-3/h11-16,18H,7-10,17H2,1-6H3/q+1.
What are the key properties of 1-(5-ethyl-3,5-dimethylheptan-3-yl)-3-(4-ethylphenyl)imidazol-1-ium?
1-(5-ethyl-3,5-dimethylheptan-3-yl)-3-(4-ethylphenyl)imidazol-1-ium has a molecular weight of 327.54 g/mol, XLogP of 5.67, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-ethyl-3,5-dimethylheptan-3-yl)-3-(4-ethylphenyl)imidazol-1-ium is sourced from PubChem (CID 123767429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).