C34H64Si — CID 123768485
dimethyl-bis[2-methyl-4,6-di(propan-2-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]silane (PubChem CID 123768485) has the molecular formula C34H64Si and a molecular weight of 500.97 g/mol. Its IUPAC name is dimethyl-bis[2-methyl-4,6-di(propan-2-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]silane.
| Compound Name | dimethyl-bis[2-methyl-4,6-di(propan-2-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]silane |
|---|---|
| PubChem CID | 123768485 |
| Molecular Formula | C34H64Si |
| Molecular Weight | 500.97 g/mol |
| Exact Mass | 500.48 |
| IUPAC Name | dimethyl-bis[2-methyl-4,6-di(propan-2-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]silane |
| SMILES | CC(C)C1CC(C(C)C)C2CC(C)C([Si](C)(C)C3C(C)CC4C(C(C)C)CC(C(C)C)CC43)C2C1 |
| InChI | InChI=1S/C34H64Si/c1-19(2)25-15-27(21(5)6)29-13-23(9)33(31(29)17-25)35(11,12)34-24(10)14-30-28(22(7)8)16-26(20(3)4)18-32(30)34/h19-34H,13-18H2,1-12H3 |
| InChIKey | BOUBVWXLRBFLTF-UHFFFAOYSA-N |
| XLogP | 10.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.97 |
| LogP ≤ 5 | 10.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|