C18H14ClN4O3+ — CID 123768763
(7-chloro-2-methoxycarbonyl-4-oxo-1-phenylquinolin-3-yl)methylimino-iminoazanium (PubChem CID 123768763) has the molecular formula C18H14ClN4O3+ and a molecular weight of 369.79 g/mol. Its IUPAC name is (7-chloro-2-methoxycarbonyl-4-oxo-1-phenylquinolin-3-yl)methylimino-iminoazanium.
| Compound Name | (7-chloro-2-methoxycarbonyl-4-oxo-1-phenylquinolin-3-yl)methylimino-iminoazanium |
|---|---|
| PubChem CID | 123768763 |
| Molecular Formula | C18H14ClN4O3+ |
| Molecular Weight | 369.79 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | (7-chloro-2-methoxycarbonyl-4-oxo-1-phenylquinolin-3-yl)methylimino-iminoazanium |
| SMILES | COC(=O)c1c(CN=[N+]=N)c(=O)c2ccc(Cl)cc2n1-c1ccccc1 |
| InChI | InChI=1S/C18H14ClN4O3/c1-26-18(25)16-14(10-21-22-20)17(24)13-8-7-11(19)9-15(13)23(16)12-5-3-2-4-6-12/h2-9,20H,10H2,1H3/q+1 |
| InChIKey | DEROZPGTTPOOOB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 98.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.79 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|