C57H99N3O5 — CID 123769064
N-[1-[8-[6-[8-(2,5-dioxopyrrol-1-yl)octyl]-3-hexyl-2-octylcyclohexyl]octyl]-2,5-dihydroxypyrrol-3-yl]-2-methyl-N-nonylprop-2-enamide (PubChem CID 123769064) has the molecular formula C57H99N3O5 and a molecular weight of 906.43 g/mol. Its IUPAC name is N-[1-[8-[6-[8-(2,5-dioxopyrrol-1-yl)octyl]-3-hexyl-2-octylcyclohexyl]octyl]-2,5-dihydroxypyrrol-3-yl]-2-methyl-N-nonylprop-2-enamide.
| Compound Name | N-[1-[8-[6-[8-(2,5-dioxopyrrol-1-yl)octyl]-3-hexyl-2-octylcyclohexyl]octyl]-2,5-dihydroxypyrrol-3-yl]-2-methyl-N-nonylprop-2-enamide |
|---|---|
| PubChem CID | 123769064 |
| Molecular Formula | C57H99N3O5 |
| Molecular Weight | 906.43 g/mol |
| Exact Mass | 905.76 |
| IUPAC Name | N-[1-[8-[6-[8-(2,5-dioxopyrrol-1-yl)octyl]-3-hexyl-2-octylcyclohexyl]octyl]-2,5-dihydroxypyrrol-3-yl]-2-methyl-N-nonylprop-2-enamide |
| SMILES | C=C(C)C(=O)N(CCCCCCCCC)c1cc(O)n(CCCCCCCCC2C(CCCCCCCCN3C(=O)C=CC3=O)CCC(CCCCCC)C2CCCCCCCC)c1O |
| InChI | InChI=1S/C57H99N3O5/c1-6-9-12-15-19-25-32-43-58(56(64)47(4)5)52-46-55(63)60(57(52)65)45-34-27-21-18-24-31-38-51-49(36-29-22-17-20-26-33-44-59-53(61)41-42-54(59)62)40-39-48(35-28-14-11-8-3)50(51)37-30-23-16-13-10-7-2/h41-42,46,48-51,63,65H,4,6-40,43-45H2,1-3,5H3 |
| InChIKey | KZOOFFNZILEYCD-UHFFFAOYSA-N |
| XLogP | 15.93 |
| TPSA | 103.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 906.43 |
| LogP ≤ 5 | 15.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|