About 2-[4-(5,6-dichloro-3-pyridinyl)butoxy]propan-2-ol
2-[4-(5,6-dichloro-3-pyridinyl)butoxy]propan-2-ol (PubChem CID 123769341) has the molecular formula C12H17Cl2NO2
and a molecular weight of 278.18 g/mol. Its IUPAC name is 2-[4-(5,6-dichloro-3-pyridinyl)butoxy]propan-2-ol.
Molecular Properties
| Compound Name | 2-[4-(5,6-dichloro-3-pyridinyl)butoxy]propan-2-ol |
| PubChem CID | 123769341 |
| Molecular Formula | C12H17Cl2NO2 |
| Molecular Weight | 278.18 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 2-[4-(5,6-dichloro-3-pyridinyl)butoxy]propan-2-ol |
| SMILES | CC(C)(O)OCCCCc1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H17Cl2NO2/c1-12(2,16)17-6-4-3-5-9-7-10(13)11(14)15-8-9/h7-8,16H,3-6H2,1-2H3 |
| InChIKey | HTKJDIBJHUAUIM-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.18 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(5,6-dichloro-3-pyridinyl)butoxy]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(5,6-dichloro-3-pyridinyl)butoxy]propan-2-ol?
The IUPAC name of 2-[4-(5,6-dichloro-3-pyridinyl)butoxy]propan-2-ol (CID 123769341) is 2-[4-(5,6-dichloro-3-pyridinyl)butoxy]propan-2-ol.
What is the SMILES notation for 2-[4-(5,6-dichloro-3-pyridinyl)butoxy]propan-2-ol?
The canonical SMILES for 2-[4-(5,6-dichloro-3-pyridinyl)butoxy]propan-2-ol is CC(C)(O)OCCCCc1cnc(Cl)c(Cl)c1.
What is the InChIKey of 2-[4-(5,6-dichloro-3-pyridinyl)butoxy]propan-2-ol?
The InChIKey is HTKJDIBJHUAUIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17Cl2NO2/c1-12(2,16)17-6-4-3-5-9-7-10(13)11(14)15-8-9/h7-8,16H,3-6H2,1-2H3.
What are the key properties of 2-[4-(5,6-dichloro-3-pyridinyl)butoxy]propan-2-ol?
2-[4-(5,6-dichloro-3-pyridinyl)butoxy]propan-2-ol has a molecular weight of 278.18 g/mol, XLogP of 3.46, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(5,6-dichloro-3-pyridinyl)butoxy]propan-2-ol is sourced from PubChem (CID 123769341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).