C23H36N2O4 — CID 123769539
17-(C,N-dimethylcarbonimidoyl)-6-methoxyimino-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2,3,14-triol (PubChem CID 123769539) has the molecular formula C23H36N2O4 and a molecular weight of 404.55 g/mol. Its IUPAC name is 17-(C,N-dimethylcarbonimidoyl)-6-methoxyimino-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2,3,14-triol.
| Compound Name | 17-(C,N-dimethylcarbonimidoyl)-6-methoxyimino-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2,3,14-triol |
|---|---|
| PubChem CID | 123769539 |
| Molecular Formula | C23H36N2O4 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | 17-(C,N-dimethylcarbonimidoyl)-6-methoxyimino-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2,3,14-triol |
| SMILES | C/N=C(\C)C1CCC2(O)C3=CC(=NOC)C4CC(O)C(O)CC4(C)C3CCC12C |
| InChI | InChI=1S/C23H36N2O4/c1-13(24-4)14-7-9-23(28)16-10-18(25-29-5)17-11-19(26)20(27)12-21(17,2)15(16)6-8-22(14,23)3/h10,14-15,17,19-20,26-28H,6-9,11-12H2,1-5H3/b24-13+,25-18? |
| InChIKey | NCUCXARGVWRNAR-ZBZKSVKSSA-N |
| XLogP | 2.71 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|