About N-methyl-2-(4-nitrosocyclohexa-2,4-dien-1-yl)ethanimine
N-methyl-2-(4-nitrosocyclohexa-2,4-dien-1-yl)ethanimine (PubChem CID 123769857) has the molecular formula C9H12N2O
and a molecular weight of 164.21 g/mol. Its IUPAC name is N-methyl-2-(4-nitrosocyclohexa-2,4-dien-1-yl)ethanimine.
Molecular Properties
| Compound Name | N-methyl-2-(4-nitrosocyclohexa-2,4-dien-1-yl)ethanimine |
| PubChem CID | 123769857 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | N-methyl-2-(4-nitrosocyclohexa-2,4-dien-1-yl)ethanimine |
| SMILES | C/N=C/CC1C=CC(N=O)=CC1 |
| InChI | InChI=1S/C9H12N2O/c1-10-7-6-8-2-4-9(11-12)5-3-8/h2,4-5,7-8H,3,6H2,1H3/b10-7+ |
| InChIKey | CSXSPPGRQKCQGN-JXMROGBWSA-N |
| XLogP | 2.30 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-2-(4-nitrosocyclohexa-2,4-dien-1-yl)ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-2-(4-nitrosocyclohexa-2,4-dien-1-yl)ethanimine?
The IUPAC name of N-methyl-2-(4-nitrosocyclohexa-2,4-dien-1-yl)ethanimine (CID 123769857) is N-methyl-2-(4-nitrosocyclohexa-2,4-dien-1-yl)ethanimine.
What is the SMILES notation for N-methyl-2-(4-nitrosocyclohexa-2,4-dien-1-yl)ethanimine?
The canonical SMILES for N-methyl-2-(4-nitrosocyclohexa-2,4-dien-1-yl)ethanimine is C/N=C/CC1C=CC(N=O)=CC1.
What is the InChIKey of N-methyl-2-(4-nitrosocyclohexa-2,4-dien-1-yl)ethanimine?
The InChIKey is CSXSPPGRQKCQGN-JXMROGBWSA-N. The full InChI is InChI=1S/C9H12N2O/c1-10-7-6-8-2-4-9(11-12)5-3-8/h2,4-5,7-8H,3,6H2,1H3/b10-7+.
What are the key properties of N-methyl-2-(4-nitrosocyclohexa-2,4-dien-1-yl)ethanimine?
N-methyl-2-(4-nitrosocyclohexa-2,4-dien-1-yl)ethanimine has a molecular weight of 164.21 g/mol, XLogP of 2.30, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-2-(4-nitrosocyclohexa-2,4-dien-1-yl)ethanimine is sourced from PubChem (CID 123769857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).