C13H17ClN2 — CID 123770228
6-chloro-4,11,12-trimethyl-2,8-diazabicyclo[5.5.0]dodeca-1(12),2,6,8-tetraene (PubChem CID 123770228) has the molecular formula C13H17ClN2 and a molecular weight of 236.75 g/mol. Its IUPAC name is 6-chloro-4,11,12-trimethyl-2,8-diazabicyclo[5.5.0]dodeca-1(12),2,6,8-tetraene.
| Compound Name | 6-chloro-4,11,12-trimethyl-2,8-diazabicyclo[5.5.0]dodeca-1(12),2,6,8-tetraene |
|---|---|
| PubChem CID | 123770228 |
| Molecular Formula | C13H17ClN2 |
| Molecular Weight | 236.75 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 6-chloro-4,11,12-trimethyl-2,8-diazabicyclo[5.5.0]dodeca-1(12),2,6,8-tetraene |
| SMILES | CC1=C2N=CC(C)CC(Cl)=C2N=CCC1C |
| InChI | InChI=1S/C13H17ClN2/c1-8-6-11(14)13-12(16-7-8)10(3)9(2)4-5-15-13/h5,7-9H,4,6H2,1-3H3 |
| InChIKey | ZSZAKKKESXNWPD-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.75 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |