C33H58F2N8O2 — CID 123770411
3,3-diamino-N-[4-[4-[3-(azetidin-1-yl)azetidine-1-carbonyl]piperidin-1-yl]-5-fluoropiperidin-3-yl]-2-(3-fluoro-7-pentyl-3,4,5,6,7,8-hexahydro-2H-azonin-9-yl)propanamide (PubChem CID 123770411) has the molecular formula C33H58F2N8O2 and a molecular weight of 636.88 g/mol. Its IUPAC name is 3,3-diamino-N-[4-[4-[3-(azetidin-1-yl)azetidine-1-carbonyl]piperidin-1-yl]-5-fluoropiperidin-3-yl]-2-(3-fluoro-7-pentyl-3,4,5,6,7,8-hexahydro-2H-azonin-9-yl)propanamide.
| Compound Name | 3,3-diamino-N-[4-[4-[3-(azetidin-1-yl)azetidine-1-carbonyl]piperidin-1-yl]-5-fluoropiperidin-3-yl]-2-(3-fluoro-7-pentyl-3,4,5,6,7,8-hexahydro-2H-azonin-9-yl)propanamide |
|---|---|
| PubChem CID | 123770411 |
| Molecular Formula | C33H58F2N8O2 |
| Molecular Weight | 636.88 g/mol |
| Exact Mass | 636.47 |
| IUPAC Name | 3,3-diamino-N-[4-[4-[3-(azetidin-1-yl)azetidine-1-carbonyl]piperidin-1-yl]-5-fluoropiperidin-3-yl]-2-(3-fluoro-7-pentyl-3,4,5,6,7,8-hexahydro-2H-azonin-9-yl)propanamide |
| SMILES | CCCCCC1CCCC(F)C/N=C(/C(C(=O)NC2CNCC(F)C2N2CCC(C(=O)N3CC(N4CCC4)C3)CC2)C(N)N)C1 |
| InChI | InChI=1S/C33H58F2N8O2/c1-2-3-4-7-22-8-5-9-24(34)17-39-27(16-22)29(31(36)37)32(44)40-28-19-38-18-26(35)30(28)42-14-10-23(11-15-42)33(45)43-20-25(21-43)41-12-6-13-41/h22-26,28-31,38H,2-21,36-37H2,1H3,(H,40,44)/b39-27+ |
| InChIKey | JKWCBZPRFVLTMD-XOKHWMEBSA-N |
| XLogP | 1.82 |
| TPSA | 132.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.88 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|