About 6H-pyrrolo[2,3-f]quinolin-1-ium-9-amine
6H-pyrrolo[2,3-f]quinolin-1-ium-9-amine (PubChem CID 123770483) has the molecular formula C11H10N3+
and a molecular weight of 184.22 g/mol. Its IUPAC name is 6H-pyrrolo[2,3-f]quinolin-1-ium-9-amine.
Molecular Properties
| Compound Name | 6H-pyrrolo[2,3-f]quinolin-1-ium-9-amine |
| PubChem CID | 123770483 |
| Molecular Formula | C11H10N3+ |
| Molecular Weight | 184.22 g/mol |
| Exact Mass | 184.09 |
| IUPAC Name | 6H-pyrrolo[2,3-f]quinolin-1-ium-9-amine |
| SMILES | Nc1cc[nH]c2ccc3cc[nH+]c3c12 |
| InChI | InChI=1S/C11H9N3/c12-8-4-6-13-9-2-1-7-3-5-14-11(7)10(8)9/h1-6,13H,12H2/p+1 |
| InChIKey | AGZPJYOPILOHNY-UHFFFAOYSA-O |
| XLogP | 1.72 |
| TPSA | 55.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.22 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6H-pyrrolo[2,3-f]quinolin-1-ium-9-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6H-pyrrolo[2,3-f]quinolin-1-ium-9-amine?
The IUPAC name of 6H-pyrrolo[2,3-f]quinolin-1-ium-9-amine (CID 123770483) is 6H-pyrrolo[2,3-f]quinolin-1-ium-9-amine.
What is the SMILES notation for 6H-pyrrolo[2,3-f]quinolin-1-ium-9-amine?
The canonical SMILES for 6H-pyrrolo[2,3-f]quinolin-1-ium-9-amine is Nc1cc[nH]c2ccc3cc[nH+]c3c12.
What is the InChIKey of 6H-pyrrolo[2,3-f]quinolin-1-ium-9-amine?
The InChIKey is AGZPJYOPILOHNY-UHFFFAOYSA-O. The full InChI is InChI=1S/C11H9N3/c12-8-4-6-13-9-2-1-7-3-5-14-11(7)10(8)9/h1-6,13H,12H2/p+1.
What are the key properties of 6H-pyrrolo[2,3-f]quinolin-1-ium-9-amine?
6H-pyrrolo[2,3-f]quinolin-1-ium-9-amine has a molecular weight of 184.22 g/mol, XLogP of 1.72, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6H-pyrrolo[2,3-f]quinolin-1-ium-9-amine is sourced from PubChem (CID 123770483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).