C21H29F2NO4 — CID 123770723
methyl 7-[3,3-difluoro-5-(4-methyl-3-oxooct-1-en-6-ynyl)-2-oxopyrrolidin-1-yl]heptanoate (PubChem CID 123770723) has the molecular formula C21H29F2NO4 and a molecular weight of 397.46 g/mol. Its IUPAC name is methyl 7-[3,3-difluoro-5-(4-methyl-3-oxooct-1-en-6-ynyl)-2-oxopyrrolidin-1-yl]heptanoate.
| Compound Name | methyl 7-[3,3-difluoro-5-(4-methyl-3-oxooct-1-en-6-ynyl)-2-oxopyrrolidin-1-yl]heptanoate |
|---|---|
| PubChem CID | 123770723 |
| Molecular Formula | C21H29F2NO4 |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | methyl 7-[3,3-difluoro-5-(4-methyl-3-oxooct-1-en-6-ynyl)-2-oxopyrrolidin-1-yl]heptanoate |
| SMILES | CC#CCC(C)C(=O)C=CC1CC(F)(F)C(=O)N1CCCCCCC(=O)OC |
| InChI | InChI=1S/C21H29F2NO4/c1-4-5-10-16(2)18(25)13-12-17-15-21(22,23)20(27)24(17)14-9-7-6-8-11-19(26)28-3/h12-13,16-17H,6-11,14-15H2,1-3H3 |
| InChIKey | HHFPFEKHPIPOGM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|