C24H33Cl2N5O — CID 123771166
4-N-[5-chloro-4-[2-chloro-4-ethyl-5-(oxan-4-ylmethylamino)-3-pyridinyl]-2-pyridinyl]cyclohexane-1,4-diamine (PubChem CID 123771166) has the molecular formula C24H33Cl2N5O and a molecular weight of 478.47 g/mol. Its IUPAC name is 4-N-[5-chloro-4-[2-chloro-4-ethyl-5-(oxan-4-ylmethylamino)-3-pyridinyl]-2-pyridinyl]cyclohexane-1,4-diamine.
| Compound Name | 4-N-[5-chloro-4-[2-chloro-4-ethyl-5-(oxan-4-ylmethylamino)-3-pyridinyl]-2-pyridinyl]cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 123771166 |
| Molecular Formula | C24H33Cl2N5O |
| Molecular Weight | 478.47 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | 4-N-[5-chloro-4-[2-chloro-4-ethyl-5-(oxan-4-ylmethylamino)-3-pyridinyl]-2-pyridinyl]cyclohexane-1,4-diamine |
| SMILES | CCc1c(NCC2CCOCC2)cnc(Cl)c1-c1cc(NC2CCC(N)CC2)ncc1Cl |
| InChI | InChI=1S/C24H33Cl2N5O/c1-2-18-21(28-12-15-7-9-32-10-8-15)14-30-24(26)23(18)19-11-22(29-13-20(19)25)31-17-5-3-16(27)4-6-17/h11,13-17,28H,2-10,12,27H2,1H3,(H,29,31) |
| InChIKey | XDKLIQNYCAUSIL-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.47 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|