C30H26ClFN6O6 — CID 123771373
4-[[2-[3-[3-chloro-2-fluoro-6-(tetrazol-1-yl)phenyl]prop-2-enoyl]-5-(2-methoxyethoxy)-3,4-dihydro-1H-isoquinoline-1-carbonyl]amino]benzoic acid (PubChem CID 123771373) has the molecular formula C30H26ClFN6O6 and a molecular weight of 621.03 g/mol. Its IUPAC name is 4-[[2-[3-[3-chloro-2-fluoro-6-(tetrazol-1-yl)phenyl]prop-2-enoyl]-5-(2-methoxyethoxy)-3,4-dihydro-1H-isoquinoline-1-carbonyl]amino]benzoic acid.
| Compound Name | 4-[[2-[3-[3-chloro-2-fluoro-6-(tetrazol-1-yl)phenyl]prop-2-enoyl]-5-(2-methoxyethoxy)-3,4-dihydro-1H-isoquinoline-1-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 123771373 |
| Molecular Formula | C30H26ClFN6O6 |
| Molecular Weight | 621.03 g/mol |
| Exact Mass | 620.16 |
| IUPAC Name | 4-[[2-[3-[3-chloro-2-fluoro-6-(tetrazol-1-yl)phenyl]prop-2-enoyl]-5-(2-methoxyethoxy)-3,4-dihydro-1H-isoquinoline-1-carbonyl]amino]benzoic acid |
| SMILES | COCCOc1cccc2c1CCN(C(=O)C=Cc1c(-n3cnnn3)ccc(Cl)c1F)C2C(=O)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C30H26ClFN6O6/c1-43-15-16-44-25-4-2-3-21-20(25)13-14-37(28(21)29(40)34-19-7-5-18(6-8-19)30(41)42)26(39)12-9-22-24(38-17-33-35-36-38)11-10-23(31)27(22)32/h2-12,17,28H,13-16H2,1H3,(H,34,40)(H,41,42) |
| InChIKey | MVQLGVFFPDIDOJ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 148.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.03 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|