C23H26N6O3S — CID 123771423
8-ethyl-2-[4-[(3-methylphenyl)methylcarbamothioyl]piperazin-1-yl]-5-oxopyrido[2,3-d]pyrimidine-6-carboxylic acid (PubChem CID 123771423) has the molecular formula C23H26N6O3S and a molecular weight of 466.57 g/mol. Its IUPAC name is 8-ethyl-2-[4-[(3-methylphenyl)methylcarbamothioyl]piperazin-1-yl]-5-oxopyrido[2,3-d]pyrimidine-6-carboxylic acid.
| Compound Name | 8-ethyl-2-[4-[(3-methylphenyl)methylcarbamothioyl]piperazin-1-yl]-5-oxopyrido[2,3-d]pyrimidine-6-carboxylic acid |
|---|---|
| PubChem CID | 123771423 |
| Molecular Formula | C23H26N6O3S |
| Molecular Weight | 466.57 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | 8-ethyl-2-[4-[(3-methylphenyl)methylcarbamothioyl]piperazin-1-yl]-5-oxopyrido[2,3-d]pyrimidine-6-carboxylic acid |
| SMILES | CCn1cc(C(=O)O)c(=O)c2cnc(N3CCN(C(=S)NCc4cccc(C)c4)CC3)nc21 |
| InChI | InChI=1S/C23H26N6O3S/c1-3-27-14-18(21(31)32)19(30)17-13-24-22(26-20(17)27)28-7-9-29(10-8-28)23(33)25-12-16-6-4-5-15(2)11-16/h4-6,11,13-14H,3,7-10,12H2,1-2H3,(H,25,33)(H,31,32) |
| InChIKey | ILRUYWLGHQFYCC-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.57 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|