About 3-methyl-2,3-dihydro-1H-indazol-5-ol
3-methyl-2,3-dihydro-1H-indazol-5-ol (PubChem CID 123771748) has the molecular formula C8H10N2O
and a molecular weight of 150.18 g/mol. Its IUPAC name is 3-methyl-2,3-dihydro-1H-indazol-5-ol.
Molecular Properties
| Compound Name | 3-methyl-2,3-dihydro-1H-indazol-5-ol |
| PubChem CID | 123771748 |
| Molecular Formula | C8H10N2O |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | 3-methyl-2,3-dihydro-1H-indazol-5-ol |
| SMILES | CC1NNc2ccc(O)cc21 |
| InChI | InChI=1S/C8H10N2O/c1-5-7-4-6(11)2-3-8(7)10-9-5/h2-5,9-11H,1H3 |
| InChIKey | SSAJVOWAVGMIKY-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-2,3-dihydro-1H-indazol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2,3-dihydro-1H-indazol-5-ol?
The IUPAC name of 3-methyl-2,3-dihydro-1H-indazol-5-ol (CID 123771748) is 3-methyl-2,3-dihydro-1H-indazol-5-ol.
What is the SMILES notation for 3-methyl-2,3-dihydro-1H-indazol-5-ol?
The canonical SMILES for 3-methyl-2,3-dihydro-1H-indazol-5-ol is CC1NNc2ccc(O)cc21.
What is the InChIKey of 3-methyl-2,3-dihydro-1H-indazol-5-ol?
The InChIKey is SSAJVOWAVGMIKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O/c1-5-7-4-6(11)2-3-8(7)10-9-5/h2-5,9-11H,1H3.
What are the key properties of 3-methyl-2,3-dihydro-1H-indazol-5-ol?
3-methyl-2,3-dihydro-1H-indazol-5-ol has a molecular weight of 150.18 g/mol, XLogP of 1.38, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2,3-dihydro-1H-indazol-5-ol is sourced from PubChem (CID 123771748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).