C22H20S2Si2 — CID 123772289
9,9,20,20-tetramethyl-5,16-dithia-9,20-disilahexacyclo[10.10.0.03,10.04,8.014,21.015,19]docosa-1,3(10),4(8),6,11,13,15(19),17,21-nonaene (PubChem CID 123772289) has the molecular formula C22H20S2Si2 and a molecular weight of 404.71 g/mol. Its IUPAC name is 9,9,20,20-tetramethyl-5,16-dithia-9,20-disilahexacyclo[10.10.0.03,10.04,8.014,21.015,19]docosa-1,3(10),4(8),6,11,13,15(19),17,21-nonaene.
| Compound Name | 9,9,20,20-tetramethyl-5,16-dithia-9,20-disilahexacyclo[10.10.0.03,10.04,8.014,21.015,19]docosa-1,3(10),4(8),6,11,13,15(19),17,21-nonaene |
|---|---|
| PubChem CID | 123772289 |
| Molecular Formula | C22H20S2Si2 |
| Molecular Weight | 404.71 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | 9,9,20,20-tetramethyl-5,16-dithia-9,20-disilahexacyclo[10.10.0.03,10.04,8.014,21.015,19]docosa-1,3(10),4(8),6,11,13,15(19),17,21-nonaene |
| SMILES | C[Si]1(C)c2cc3cc4c(cc3cc2-c2sccc21)[Si](C)(C)c1ccsc1-4 |
| InChI | InChI=1S/C22H20S2Si2/c1-25(2)17-5-7-23-21(17)15-9-14-12-20-16(10-13(14)11-19(15)25)22-18(6-8-24-22)26(20,3)4/h5-12H,1-4H3 |
| InChIKey | NABODHCCAAESHR-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.71 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|