C10H16N2 — CID 123772432
(2E,3Z)-2-ethylidene-3,5-dimethylhexa-3,5-dienimidamide (PubChem CID 123772432) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is (2E,3Z)-2-ethylidene-3,5-dimethylhexa-3,5-dienimidamide.
| Compound Name | (2E,3Z)-2-ethylidene-3,5-dimethylhexa-3,5-dienimidamide |
|---|---|
| PubChem CID | 123772432 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | (2E,3Z)-2-ethylidene-3,5-dimethylhexa-3,5-dienimidamide |
| SMILES | [H]/N=C(N)/C(=C/C)C(/C)=C/C(=C)C |
| InChI | InChI=1S/C10H16N2/c1-5-9(10(11)12)8(4)6-7(2)3/h5-6H,2H2,1,3-4H3,(H3,11,12)/b8-6-,9-5- |
| InChIKey | MSDZBCFQTFFYGK-VZPCVYTNSA-N |
| XLogP | 2.39 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|