C15H10F18O4 — CID 123772947
1-[1,1,1,2,4,5,5,5-octafluoro-4-(1,1,2,2,3,3,3-heptafluoropropoxy)-3-oxopentan-2-yl]oxy-4-(trifluoromethyl)hexan-3-one (PubChem CID 123772947) has the molecular formula C15H10F18O4 and a molecular weight of 596.21 g/mol. Its IUPAC name is 1-[1,1,1,2,4,5,5,5-octafluoro-4-(1,1,2,2,3,3,3-heptafluoropropoxy)-3-oxopentan-2-yl]oxy-4-(trifluoromethyl)hexan-3-one.
| Compound Name | 1-[1,1,1,2,4,5,5,5-octafluoro-4-(1,1,2,2,3,3,3-heptafluoropropoxy)-3-oxopentan-2-yl]oxy-4-(trifluoromethyl)hexan-3-one |
|---|---|
| PubChem CID | 123772947 |
| Molecular Formula | C15H10F18O4 |
| Molecular Weight | 596.21 g/mol |
| Exact Mass | 596.03 |
| IUPAC Name | 1-[1,1,1,2,4,5,5,5-octafluoro-4-(1,1,2,2,3,3,3-heptafluoropropoxy)-3-oxopentan-2-yl]oxy-4-(trifluoromethyl)hexan-3-one |
| SMILES | CCC(C(=O)CCOC(F)(C(=O)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H10F18O4/c1-2-5(10(18,19)20)6(34)3-4-36-8(16,12(23,24)25)7(35)9(17,13(26,27)28)37-15(32,33)11(21,22)14(29,30)31/h5H,2-4H2,1H3 |
| InChIKey | PMBXKFVWUNYHEO-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.21 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|