C9H15NO3 — CID 123773313
methyl 4-hydroxy-2-prop-1-en-2-ylpyrrolidine-1-carboxylate (PubChem CID 123773313) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is methyl 4-hydroxy-2-prop-1-en-2-ylpyrrolidine-1-carboxylate.
| Compound Name | methyl 4-hydroxy-2-prop-1-en-2-ylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 123773313 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | methyl 4-hydroxy-2-prop-1-en-2-ylpyrrolidine-1-carboxylate |
| SMILES | C=C(C)C1CC(O)CN1C(=O)OC |
| InChI | InChI=1S/C9H15NO3/c1-6(2)8-4-7(11)5-10(8)9(12)13-3/h7-8,11H,1,4-5H2,2-3H3 |
| InChIKey | CGMKIWDFPXOASP-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|