C23H45F3O3 — CID 123773546
3,5-dimethyl-5-(pentan-3-yloxymethyl)-6-(5,5,5-trifluoro-2,2,4,4-tetramethylpentoxy)hexan-3-ol (PubChem CID 123773546) has the molecular formula C23H45F3O3 and a molecular weight of 426.60 g/mol. Its IUPAC name is 3,5-dimethyl-5-(pentan-3-yloxymethyl)-6-(5,5,5-trifluoro-2,2,4,4-tetramethylpentoxy)hexan-3-ol.
| Compound Name | 3,5-dimethyl-5-(pentan-3-yloxymethyl)-6-(5,5,5-trifluoro-2,2,4,4-tetramethylpentoxy)hexan-3-ol |
|---|---|
| PubChem CID | 123773546 |
| Molecular Formula | C23H45F3O3 |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.33 |
| IUPAC Name | 3,5-dimethyl-5-(pentan-3-yloxymethyl)-6-(5,5,5-trifluoro-2,2,4,4-tetramethylpentoxy)hexan-3-ol |
| SMILES | CCC(CC)OCC(C)(COCC(C)(C)CC(C)(C)C(F)(F)F)CC(C)(O)CC |
| InChI | InChI=1S/C23H45F3O3/c1-10-18(11-2)29-17-21(8,14-22(9,27)12-3)16-28-15-19(4,5)13-20(6,7)23(24,25)26/h18,27H,10-17H2,1-9H3 |
| InChIKey | OOKDXMDIZOQAAG-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |