C16H15N — CID 123773831
5,6b,10a,10c-tetrahydro-2H-fluoranthen-3-imine (PubChem CID 123773831) has the molecular formula C16H15N and a molecular weight of 221.30 g/mol. Its IUPAC name is 5,6b,10a,10c-tetrahydro-2H-fluoranthen-3-imine.
| Compound Name | 5,6b,10a,10c-tetrahydro-2H-fluoranthen-3-imine |
|---|---|
| PubChem CID | 123773831 |
| Molecular Formula | C16H15N |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 5,6b,10a,10c-tetrahydro-2H-fluoranthen-3-imine |
| SMILES | [H]/N=C1\CC=C2C3C1=CCC=C3C1C=CC=CC21 |
| InChI | InChI=1S/C16H15N/c17-15-9-8-13-11-5-2-1-4-10(11)12-6-3-7-14(15)16(12)13/h1-2,4-8,10-11,16-17H,3,9H2/b17-15+ |
| InChIKey | OHLVCIDONORCEL-BMRADRMJSA-N |
| XLogP | 3.58 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|