About 3-(3,5-dimethylcyclohexa-1,3-dien-1-yl)oxyoxolane
3-(3,5-dimethylcyclohexa-1,3-dien-1-yl)oxyoxolane (PubChem CID 123774750) has the molecular formula C12H18O2
and a molecular weight of 194.27 g/mol. Its IUPAC name is 3-(3,5-dimethylcyclohexa-1,3-dien-1-yl)oxyoxolane.
Molecular Properties
| Compound Name | 3-(3,5-dimethylcyclohexa-1,3-dien-1-yl)oxyoxolane |
| PubChem CID | 123774750 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 3-(3,5-dimethylcyclohexa-1,3-dien-1-yl)oxyoxolane |
| SMILES | CC1=CC(C)CC(OC2CCOC2)=C1 |
| InChI | InChI=1S/C12H18O2/c1-9-5-10(2)7-12(6-9)14-11-3-4-13-8-11/h5-6,10-11H,3-4,7-8H2,1-2H3 |
| InChIKey | RLHBMCGDBWKOKH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(3,5-dimethylcyclohexa-1,3-dien-1-yl)oxyoxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-dimethylcyclohexa-1,3-dien-1-yl)oxyoxolane?
The IUPAC name of 3-(3,5-dimethylcyclohexa-1,3-dien-1-yl)oxyoxolane (CID 123774750) is 3-(3,5-dimethylcyclohexa-1,3-dien-1-yl)oxyoxolane.
What is the SMILES notation for 3-(3,5-dimethylcyclohexa-1,3-dien-1-yl)oxyoxolane?
The canonical SMILES for 3-(3,5-dimethylcyclohexa-1,3-dien-1-yl)oxyoxolane is CC1=CC(C)CC(OC2CCOC2)=C1.
What is the InChIKey of 3-(3,5-dimethylcyclohexa-1,3-dien-1-yl)oxyoxolane?
The InChIKey is RLHBMCGDBWKOKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O2/c1-9-5-10(2)7-12(6-9)14-11-3-4-13-8-11/h5-6,10-11H,3-4,7-8H2,1-2H3.
What are the key properties of 3-(3,5-dimethylcyclohexa-1,3-dien-1-yl)oxyoxolane?
3-(3,5-dimethylcyclohexa-1,3-dien-1-yl)oxyoxolane has a molecular weight of 194.27 g/mol, XLogP of 2.66, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-dimethylcyclohexa-1,3-dien-1-yl)oxyoxolane is sourced from PubChem (CID 123774750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).