C15H18BrN3O3 — CID 123775041
(2S)-2-acetamido-N-[(3-bromo-2,5-dihydro-1,2-oxazol-5-yl)methyl]-3-phenylpropanamide (PubChem CID 123775041) has the molecular formula C15H18BrN3O3 and a molecular weight of 368.23 g/mol. Its IUPAC name is (2S)-2-acetamido-N-[(3-bromo-2,5-dihydro-1,2-oxazol-5-yl)methyl]-3-phenylpropanamide.
| Compound Name | (2S)-2-acetamido-N-[(3-bromo-2,5-dihydro-1,2-oxazol-5-yl)methyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 123775041 |
| Molecular Formula | C15H18BrN3O3 |
| Molecular Weight | 368.23 g/mol |
| Exact Mass | 367.05 |
| IUPAC Name | (2S)-2-acetamido-N-[(3-bromo-2,5-dihydro-1,2-oxazol-5-yl)methyl]-3-phenylpropanamide |
| SMILES | CC(=O)N[C@@H](Cc1ccccc1)C(=O)NCC1C=C(Br)NO1 |
| InChI | InChI=1S/C15H18BrN3O3/c1-10(20)18-13(7-11-5-3-2-4-6-11)15(21)17-9-12-8-14(16)19-22-12/h2-6,8,12-13,19H,7,9H2,1H3,(H,17,21)(H,18,20)/t12?,13-/m0/s1 |
| InChIKey | QCHDCVFSSOHAOU-ABLWVSNPSA-N |
| XLogP | 0.99 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.23 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|