About 2-imino-N,N-dimethylpropanamide
2-imino-N,N-dimethylpropanamide (PubChem CID 123775194) has the molecular formula C5H10N2O
and a molecular weight of 114.15 g/mol. Its IUPAC name is 2-imino-N,N-dimethylpropanamide.
Molecular Properties
| Compound Name | 2-imino-N,N-dimethylpropanamide |
| PubChem CID | 123775194 |
| Molecular Formula | C5H10N2O |
| Molecular Weight | 114.15 g/mol |
| Exact Mass | 114.08 |
| IUPAC Name | 2-imino-N,N-dimethylpropanamide |
| SMILES | [H]/N=C(\C)C(=O)N(C)C |
| InChI | InChI=1S/C5H10N2O/c1-4(6)5(8)7(2)3/h6H,1-3H3/b6-4+ |
| InChIKey | COCAMJMVPRQSOO-GQCTYLIASA-N |
| XLogP | 0.11 |
| TPSA | 44.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.15 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-imino-N,N-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-imino-N,N-dimethylpropanamide?
The IUPAC name of 2-imino-N,N-dimethylpropanamide (CID 123775194) is 2-imino-N,N-dimethylpropanamide.
What is the SMILES notation for 2-imino-N,N-dimethylpropanamide?
The canonical SMILES for 2-imino-N,N-dimethylpropanamide is [H]/N=C(\C)C(=O)N(C)C.
What is the InChIKey of 2-imino-N,N-dimethylpropanamide?
The InChIKey is COCAMJMVPRQSOO-GQCTYLIASA-N. The full InChI is InChI=1S/C5H10N2O/c1-4(6)5(8)7(2)3/h6H,1-3H3/b6-4+.
What are the key properties of 2-imino-N,N-dimethylpropanamide?
2-imino-N,N-dimethylpropanamide has a molecular weight of 114.15 g/mol, XLogP of 0.11, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-imino-N,N-dimethylpropanamide is sourced from PubChem (CID 123775194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).