C19H15F8N5O3 — CID 123775451
N-[3-[2-amino-4-methyl-6-(trifluoromethyl)-5,6-dihydro-1,3-oxazin-4-yl]-4,5-difluorophenyl]-5-(2,2,2-trifluoroethoxy)pyrazine-2-carboxamide (PubChem CID 123775451) has the molecular formula C19H15F8N5O3 and a molecular weight of 513.35 g/mol. Its IUPAC name is N-[3-[2-amino-4-methyl-6-(trifluoromethyl)-5,6-dihydro-1,3-oxazin-4-yl]-4,5-difluorophenyl]-5-(2,2,2-trifluoroethoxy)pyrazine-2-carboxamide.
| Compound Name | N-[3-[2-amino-4-methyl-6-(trifluoromethyl)-5,6-dihydro-1,3-oxazin-4-yl]-4,5-difluorophenyl]-5-(2,2,2-trifluoroethoxy)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 123775451 |
| Molecular Formula | C19H15F8N5O3 |
| Molecular Weight | 513.35 g/mol |
| Exact Mass | 513.10 |
| IUPAC Name | N-[3-[2-amino-4-methyl-6-(trifluoromethyl)-5,6-dihydro-1,3-oxazin-4-yl]-4,5-difluorophenyl]-5-(2,2,2-trifluoroethoxy)pyrazine-2-carboxamide |
| SMILES | CC1(c2cc(NC(=O)c3cnc(OCC(F)(F)F)cn3)cc(F)c2F)CC(C(F)(F)F)OC(N)=N1 |
| InChI | InChI=1S/C19H15F8N5O3/c1-17(4-12(19(25,26)27)35-16(28)32-17)9-2-8(3-10(20)14(9)21)31-15(33)11-5-30-13(6-29-11)34-7-18(22,23)24/h2-3,5-6,12H,4,7H2,1H3,(H2,28,32)(H,31,33) |
| InChIKey | LVAPAZMDWGCBAC-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 111.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.35 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |