C38H62O3 — CID 123775875
[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] (12R)-12-hydroxyoctadec-9-enoate (PubChem CID 123775875) has the molecular formula C38H62O3 and a molecular weight of 566.91 g/mol. Its IUPAC name is [3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] (12R)-12-hydroxyoctadec-9-enoate.
| Compound Name | [3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] (12R)-12-hydroxyoctadec-9-enoate |
|---|---|
| PubChem CID | 123775875 |
| Molecular Formula | C38H62O3 |
| Molecular Weight | 566.91 g/mol |
| Exact Mass | 566.47 |
| IUPAC Name | [3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] (12R)-12-hydroxyoctadec-9-enoate |
| SMILES | CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OCC=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C38H62O3/c1-7-8-9-16-24-35(39)25-17-14-12-10-11-13-15-18-26-37(40)41-31-29-33(3)22-19-21-32(2)27-28-36-34(4)23-20-30-38(36,5)6/h14,17,19,21-22,27-29,35,39H,7-13,15-16,18,20,23-26,30-31H2,1-6H3/t35-/m1/s1 |
| InChIKey | NNOXUZBUQUKXGN-PGUFJCEWSA-N |
| XLogP | 11.07 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.91 |
| LogP ≤ 5 | 11.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|