About 11-ethyl-3,9-dihydro-2H-cyclohepta[b][1,4]benzothiazine
11-ethyl-3,9-dihydro-2H-cyclohepta[b][1,4]benzothiazine (PubChem CID 123776014) has the molecular formula C15H17NS
and a molecular weight of 243.37 g/mol. Its IUPAC name is 11-ethyl-3,9-dihydro-2H-cyclohepta[b][1,4]benzothiazine.
Molecular Properties
| Compound Name | 11-ethyl-3,9-dihydro-2H-cyclohepta[b][1,4]benzothiazine |
| PubChem CID | 123776014 |
| Molecular Formula | C15H17NS |
| Molecular Weight | 243.37 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 11-ethyl-3,9-dihydro-2H-cyclohepta[b][1,4]benzothiazine |
| SMILES | CCN1C2=CCC=CC=C2SC2=CCCC=C21 |
| InChI | InChI=1S/C15H17NS/c1-2-16-12-8-4-3-5-10-14(12)17-15-11-7-6-9-13(15)16/h3,5,8-11H,2,4,6-7H2,1H3 |
| InChIKey | MEDYAVPRDWMVSF-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.37 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 11-ethyl-3,9-dihydro-2H-cyclohepta[b][1,4]benzothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-ethyl-3,9-dihydro-2H-cyclohepta[b][1,4]benzothiazine?
The IUPAC name of 11-ethyl-3,9-dihydro-2H-cyclohepta[b][1,4]benzothiazine (CID 123776014) is 11-ethyl-3,9-dihydro-2H-cyclohepta[b][1,4]benzothiazine.
What is the SMILES notation for 11-ethyl-3,9-dihydro-2H-cyclohepta[b][1,4]benzothiazine?
The canonical SMILES for 11-ethyl-3,9-dihydro-2H-cyclohepta[b][1,4]benzothiazine is CCN1C2=CCC=CC=C2SC2=CCCC=C21.
What is the InChIKey of 11-ethyl-3,9-dihydro-2H-cyclohepta[b][1,4]benzothiazine?
The InChIKey is MEDYAVPRDWMVSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NS/c1-2-16-12-8-4-3-5-10-14(12)17-15-11-7-6-9-13(15)16/h3,5,8-11H,2,4,6-7H2,1H3.
What are the key properties of 11-ethyl-3,9-dihydro-2H-cyclohepta[b][1,4]benzothiazine?
11-ethyl-3,9-dihydro-2H-cyclohepta[b][1,4]benzothiazine has a molecular weight of 243.37 g/mol, XLogP of 4.34, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 11-ethyl-3,9-dihydro-2H-cyclohepta[b][1,4]benzothiazine is sourced from PubChem (CID 123776014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).