C8H11NO2 — CID 123776275
6,7-dihydro-1,3-benzodioxol-5-ylmethanamine (PubChem CID 123776275) has the molecular formula C8H11NO2 and a molecular weight of 153.18 g/mol. Its IUPAC name is 6,7-dihydro-1,3-benzodioxol-5-ylmethanamine.
| Compound Name | 6,7-dihydro-1,3-benzodioxol-5-ylmethanamine |
|---|---|
| PubChem CID | 123776275 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | 6,7-dihydro-1,3-benzodioxol-5-ylmethanamine |
| SMILES | NCC1=CC2=C(CC1)OCO2 |
| InChI | InChI=1S/C8H11NO2/c9-4-6-1-2-7-8(3-6)11-5-10-7/h3H,1-2,4-5,9H2 |
| InChIKey | HVNAOSYSRAUTPV-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |